C12H21O2Si- — CID 163775420
tert-butyl-methyl-[[(3S)-4-oxaspiro[2.5]oct-7-en-2-yl]oxy]silanide (PubChem CID 163775420) has the molecular formula C12H21O2Si- and a molecular weight of 225.38 g/mol. Its IUPAC name is tert-butyl-methyl-[[(3S)-4-oxaspiro[2.5]oct-7-en-2-yl]oxy]silanide.
| Compound Name | tert-butyl-methyl-[[(3S)-4-oxaspiro[2.5]oct-7-en-2-yl]oxy]silanide |
|---|---|
| PubChem CID | 163775420 |
| Molecular Formula | C12H21O2Si- |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | tert-butyl-methyl-[[(3S)-4-oxaspiro[2.5]oct-7-en-2-yl]oxy]silanide |
| SMILES | C[Si-](OC1C[C@]12C=CCCO2)C(C)(C)C |
| InChI | InChI=1S/C12H21O2Si/c1-11(2,3)15(4)14-10-9-12(10)7-5-6-8-13-12/h5,7,10H,6,8-9H2,1-4H3/q-1/t10?,12-/m1/s1 |
| InChIKey | MKAABZVPIQYFSJ-TVKKRMFBSA-N |
| XLogP | 2.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|