C14H28NO2+ — CID 163781231
[(3R,4R,6R)-6-butan-2-yl-5-ethyl-2,4-dimethyl-2-(methylideneamino)oxan-3-yl]oxidanium (PubChem CID 163781231) has the molecular formula C14H28NO2+ and a molecular weight of 242.38 g/mol. Its IUPAC name is [(3R,4R,6R)-6-butan-2-yl-5-ethyl-2,4-dimethyl-2-(methylideneamino)oxan-3-yl]oxidanium.
| Compound Name | [(3R,4R,6R)-6-butan-2-yl-5-ethyl-2,4-dimethyl-2-(methylideneamino)oxan-3-yl]oxidanium |
|---|---|
| PubChem CID | 163781231 |
| Molecular Formula | C14H28NO2+ |
| Molecular Weight | 242.38 g/mol |
| Exact Mass | 242.21 |
| IUPAC Name | [(3R,4R,6R)-6-butan-2-yl-5-ethyl-2,4-dimethyl-2-(methylideneamino)oxan-3-yl]oxidanium |
| SMILES | C=NC1(C)O[C@H](C(C)CC)C(CC)[C@@H](C)[C@H]1[OH2+] |
| InChI | InChI=1S/C14H27NO2/c1-7-9(3)12-11(8-2)10(4)13(16)14(5,15-6)17-12/h9-13,16H,6-8H2,1-5H3/p+1/t9?,10-,11?,12-,13-,14?/m1/s1 |
| InChIKey | MOTJNOKTIXVDPZ-KQVZITRHSA-O |
| XLogP | 2.60 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.38 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|