C23H44O6 — CID 157141176
2-[4-[(5-ethyl-2,4,6-trimethyl-1,3-dioxan-2-yl)oxy]-3-methylpentan-2-yl]oxy-2,4,5,6-tetramethyl-1,3-dioxane (PubChem CID 157141176) has the molecular formula C23H44O6 and a molecular weight of 416.60 g/mol. Its IUPAC name is 2-[4-[(5-ethyl-2,4,6-trimethyl-1,3-dioxan-2-yl)oxy]-3-methylpentan-2-yl]oxy-2,4,5,6-tetramethyl-1,3-dioxane.
| Compound Name | 2-[4-[(5-ethyl-2,4,6-trimethyl-1,3-dioxan-2-yl)oxy]-3-methylpentan-2-yl]oxy-2,4,5,6-tetramethyl-1,3-dioxane |
|---|---|
| PubChem CID | 157141176 |
| Molecular Formula | C23H44O6 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.31 |
| IUPAC Name | 2-[4-[(5-ethyl-2,4,6-trimethyl-1,3-dioxan-2-yl)oxy]-3-methylpentan-2-yl]oxy-2,4,5,6-tetramethyl-1,3-dioxane |
| SMILES | CCC1C(C)OC(C)(OC(C)C(C)C(C)OC2(C)OC(C)C(C)C(C)O2)OC1C |
| InChI | InChI=1S/C23H44O6/c1-12-21-19(8)28-23(11,29-20(21)9)27-18(7)14(3)17(6)26-22(10)24-15(4)13(2)16(5)25-22/h13-21H,12H2,1-11H3 |
| InChIKey | PREYMZUASOIVLJ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |