C32H38N4O5S — CID 163782341
29-cyclohexyl-23-methoxy-17-methyl-11,11-dioxo-8-oxa-11λ6-thia-1,10,12,17-tetrazahexacyclo[17.8.1.12,6.13,27.07,9.021,26]triaconta-2,4,6(30),19,21(26),22,24,27(29)-octaen-18-one (PubChem CID 163782341) has the molecular formula C32H38N4O5S and a molecular weight of 590.75 g/mol. Its IUPAC name is 29-cyclohexyl-23-methoxy-17-methyl-11,11-dioxo-8-oxa-11λ6-thia-1,10,12,17-tetrazahexacyclo[17.8.1.12,6.13,27.07,9.021,26]triaconta-2,4,6(30),19,21(26),22,24,27(29)-octaen-18-one.
| Compound Name | 29-cyclohexyl-23-methoxy-17-methyl-11,11-dioxo-8-oxa-11λ6-thia-1,10,12,17-tetrazahexacyclo[17.8.1.12,6.13,27.07,9.021,26]triaconta-2,4,6(30),19,21(26),22,24,27(29)-octaen-18-one |
|---|---|
| PubChem CID | 163782341 |
| Molecular Formula | C32H38N4O5S |
| Molecular Weight | 590.75 g/mol |
| Exact Mass | 590.26 |
| IUPAC Name | 29-cyclohexyl-23-methoxy-17-methyl-11,11-dioxo-8-oxa-11λ6-thia-1,10,12,17-tetrazahexacyclo[17.8.1.12,6.13,27.07,9.021,26]triaconta-2,4,6(30),19,21(26),22,24,27(29)-octaen-18-one |
| SMILES | COc1ccc2c(c1)C=C1Cn3c-2c(C2CCCCC2)c2ccc(cc23)C2OC2NS(=O)(=O)NCCCCN(C)C1=O |
| InChI | InChI=1S/C32H38N4O5S/c1-35-15-7-6-14-33-42(38,39)34-31-30(41-31)21-10-12-26-27(18-21)36-19-23(32(35)37)16-22-17-24(40-2)11-13-25(22)29(36)28(26)20-8-4-3-5-9-20/h10-13,16-18,20,30-31,33-34H,3-9,14-15,19H2,1-2H3 |
| InChIKey | MPPOYNPBFVZZLD-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 105.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.75 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|