C20H34N2O4S2 — CID 163787140
1,3-dimorpholin-4-ylpropan-2-yl 4-[(3S)-4,5-dithiaspiro[2.4]heptan-2-yl]butanoate (PubChem CID 163787140) has the molecular formula C20H34N2O4S2 and a molecular weight of 430.64 g/mol. Its IUPAC name is 1,3-dimorpholin-4-ylpropan-2-yl 4-[(3S)-4,5-dithiaspiro[2.4]heptan-2-yl]butanoate.
| Compound Name | 1,3-dimorpholin-4-ylpropan-2-yl 4-[(3S)-4,5-dithiaspiro[2.4]heptan-2-yl]butanoate |
|---|---|
| PubChem CID | 163787140 |
| Molecular Formula | C20H34N2O4S2 |
| Molecular Weight | 430.64 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 1,3-dimorpholin-4-ylpropan-2-yl 4-[(3S)-4,5-dithiaspiro[2.4]heptan-2-yl]butanoate |
| SMILES | O=C(CCCC1C[C@]12CCSS2)OC(CN1CCOCC1)CN1CCOCC1 |
| InChI | InChI=1S/C20H34N2O4S2/c23-19(3-1-2-17-14-20(17)4-13-27-28-20)26-18(15-21-5-9-24-10-6-21)16-22-7-11-25-12-8-22/h17-18H,1-16H2/t17?,20-/m1/s1 |
| InChIKey | MTNANFWXGHIELG-UUSAFJCLSA-N |
| XLogP | 2.28 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.64 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|