About (8-chloro-1,7-naphthyridin-2-yl)-methylidyneazanium
(8-chloro-1,7-naphthyridin-2-yl)-methylidyneazanium (PubChem CID 163792680) has the molecular formula C9H5ClN3+
and a molecular weight of 190.61 g/mol. Its IUPAC name is (8-chloro-1,7-naphthyridin-2-yl)-methylidyneazanium.
Molecular Properties
| Compound Name | (8-chloro-1,7-naphthyridin-2-yl)-methylidyneazanium |
| PubChem CID | 163792680 |
| Molecular Formula | C9H5ClN3+ |
| Molecular Weight | 190.61 g/mol |
| Exact Mass | 190.02 |
| IUPAC Name | (8-chloro-1,7-naphthyridin-2-yl)-methylidyneazanium |
| SMILES | C#[N+]c1ccc2ccnc(Cl)c2n1 |
| InChI | InChI=1S/C9H5ClN3/c1-11-7-3-2-6-4-5-12-9(10)8(6)13-7/h1-5H/q+1 |
| InChIKey | IQQDSHLRPKUGPC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 30.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.61 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (8-chloro-1,7-naphthyridin-2-yl)-methylidyneazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-chloro-1,7-naphthyridin-2-yl)-methylidyneazanium?
The IUPAC name of (8-chloro-1,7-naphthyridin-2-yl)-methylidyneazanium (CID 163792680) is (8-chloro-1,7-naphthyridin-2-yl)-methylidyneazanium.
What is the SMILES notation for (8-chloro-1,7-naphthyridin-2-yl)-methylidyneazanium?
The canonical SMILES for (8-chloro-1,7-naphthyridin-2-yl)-methylidyneazanium is C#[N+]c1ccc2ccnc(Cl)c2n1.
What is the InChIKey of (8-chloro-1,7-naphthyridin-2-yl)-methylidyneazanium?
The InChIKey is IQQDSHLRPKUGPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5ClN3/c1-11-7-3-2-6-4-5-12-9(10)8(6)13-7/h1-5H/q+1.
What are the key properties of (8-chloro-1,7-naphthyridin-2-yl)-methylidyneazanium?
(8-chloro-1,7-naphthyridin-2-yl)-methylidyneazanium has a molecular weight of 190.61 g/mol, XLogP of 2.88, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (8-chloro-1,7-naphthyridin-2-yl)-methylidyneazanium is sourced from PubChem (CID 163792680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).