C18H9Cl5FeN2O+2 — CID 158371036
iron(2+);2,3,4,5,6-pentachlorophenol;1,10-phenanthroline (PubChem CID 158371036) has the molecular formula C18H9Cl5FeN2O+2 and a molecular weight of 502.39 g/mol. Its IUPAC name is iron(2+);2,3,4,5,6-pentachlorophenol;1,10-phenanthroline.
| Compound Name | iron(2+);2,3,4,5,6-pentachlorophenol;1,10-phenanthroline |
|---|---|
| PubChem CID | 158371036 |
| Molecular Formula | C18H9Cl5FeN2O+2 |
| Molecular Weight | 502.39 g/mol |
| Exact Mass | 499.85 |
| IUPAC Name | iron(2+);2,3,4,5,6-pentachlorophenol;1,10-phenanthroline |
| SMILES | Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl.[Fe+2].c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H8N2.C6HCl5O.Fe/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;7-1-2(8)4(10)6(12)5(11)3(1)9;/h1-8H;12H;/q;;+2 |
| InChIKey | GUPPJFUGADZYGT-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.39 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|