C12H23BO2S — CID 163796333
(Z,4S)-4-(4,4-dimethyl-5-propan-2-yl-1,3,2-dioxaborolan-2-yl)pent-2-ene-2-thiol (PubChem CID 163796333) has the molecular formula C12H23BO2S and a molecular weight of 242.19 g/mol. Its IUPAC name is (Z,4S)-4-(4,4-dimethyl-5-propan-2-yl-1,3,2-dioxaborolan-2-yl)pent-2-ene-2-thiol.
| Compound Name | (Z,4S)-4-(4,4-dimethyl-5-propan-2-yl-1,3,2-dioxaborolan-2-yl)pent-2-ene-2-thiol |
|---|---|
| PubChem CID | 163796333 |
| Molecular Formula | C12H23BO2S |
| Molecular Weight | 242.19 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | (Z,4S)-4-(4,4-dimethyl-5-propan-2-yl-1,3,2-dioxaborolan-2-yl)pent-2-ene-2-thiol |
| SMILES | C/C(S)=C/[C@H](C)B1OC(C(C)C)C(C)(C)O1 |
| InChI | InChI=1S/C12H23BO2S/c1-8(2)11-12(5,6)15-13(14-11)9(3)7-10(4)16/h7-9,11,16H,1-6H3/b10-7-/t9-,11?/m0/s1 |
| InChIKey | NBCLRWCNMBVXRI-FRRDIBPTSA-N |
| XLogP | 3.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.19 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|