C18H24N2O8 — CID 163800205
(Z)-4-[[5-[[(Z)-3-carboxyprop-2-enoyl]amino]-3,6-dioxodecan-4-yl]amino]-4-oxobut-2-enoic acid (PubChem CID 163800205) has the molecular formula C18H24N2O8 and a molecular weight of 396.40 g/mol. Its IUPAC name is (Z)-4-[[5-[[(Z)-3-carboxyprop-2-enoyl]amino]-3,6-dioxodecan-4-yl]amino]-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[[5-[[(Z)-3-carboxyprop-2-enoyl]amino]-3,6-dioxodecan-4-yl]amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 163800205 |
| Molecular Formula | C18H24N2O8 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | (Z)-4-[[5-[[(Z)-3-carboxyprop-2-enoyl]amino]-3,6-dioxodecan-4-yl]amino]-4-oxobut-2-enoic acid |
| SMILES | CCCCC(=O)C(NC(=O)/C=C\C(=O)O)C(NC(=O)/C=C\C(=O)O)C(=O)CC |
| InChI | InChI=1S/C18H24N2O8/c1-3-5-6-12(22)18(20-14(24)8-10-16(27)28)17(11(21)4-2)19-13(23)7-9-15(25)26/h7-10,17-18H,3-6H2,1-2H3,(H,19,23)(H,20,24)(H,25,26)(H,27,28)/b9-7-,10-8- |
| InChIKey | ZOWUHMIJCGSUOS-XOHWUJONSA-N |
| XLogP | -0.02 |
| TPSA | 166.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|