C18H16N2 — CID 163800958
3,5-diphenyl-2,4-diazabicyclo[4.2.0]octa-2,4-diene (PubChem CID 163800958) has the molecular formula C18H16N2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 3,5-diphenyl-2,4-diazabicyclo[4.2.0]octa-2,4-diene.
| Compound Name | 3,5-diphenyl-2,4-diazabicyclo[4.2.0]octa-2,4-diene |
|---|---|
| PubChem CID | 163800958 |
| Molecular Formula | C18H16N2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 3,5-diphenyl-2,4-diazabicyclo[4.2.0]octa-2,4-diene |
| SMILES | c1ccc(C2=NC3CCC3C(c3ccccc3)=N2)cc1 |
| InChI | InChI=1S/C18H16N2/c1-3-7-13(8-4-1)17-15-11-12-16(15)19-18(20-17)14-9-5-2-6-10-14/h1-10,15-16H,11-12H2 |
| InChIKey | NEXKNTHYQZQYGL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |