C15H13N3S — CID 6940266
(2S)-2,4-diphenyl-2H-1,3,5-thiadiazin-6-amine (PubChem CID 6940266) has the molecular formula C15H13N3S and a molecular weight of 267.36 g/mol. Its IUPAC name is (2S)-2,4-diphenyl-2H-1,3,5-thiadiazin-6-amine.
| Compound Name | (2S)-2,4-diphenyl-2H-1,3,5-thiadiazin-6-amine |
|---|---|
| PubChem CID | 6940266 |
| Molecular Formula | C15H13N3S |
| Molecular Weight | 267.36 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | (2S)-2,4-diphenyl-2H-1,3,5-thiadiazin-6-amine |
| SMILES | NC1=NC(c2ccccc2)=N[C@H](c2ccccc2)S1 |
| InChI | InChI=1S/C15H13N3S/c16-15-18-13(11-7-3-1-4-8-11)17-14(19-15)12-9-5-2-6-10-12/h1-10,14H,(H2,16,17,18)/t14-/m0/s1 |
| InChIKey | BQAVCRXNKJWKFM-AWEZNQCLSA-N |
| XLogP | 3.19 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |