C22H18ClN3 — CID 170004068
4-(4-chlorophenyl)-1-methyl-2,6-diphenyl-2H-1,3,5-triazine (PubChem CID 170004068) has the molecular formula C22H18ClN3 and a molecular weight of 359.86 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-1-methyl-2,6-diphenyl-2H-1,3,5-triazine.
| Compound Name | 4-(4-chlorophenyl)-1-methyl-2,6-diphenyl-2H-1,3,5-triazine |
|---|---|
| PubChem CID | 170004068 |
| Molecular Formula | C22H18ClN3 |
| Molecular Weight | 359.86 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 4-(4-chlorophenyl)-1-methyl-2,6-diphenyl-2H-1,3,5-triazine |
| SMILES | CN1C(c2ccccc2)=NC(c2ccc(Cl)cc2)=NC1c1ccccc1 |
| InChI | InChI=1S/C22H18ClN3/c1-26-21(17-8-4-2-5-9-17)24-20(16-12-14-19(23)15-13-16)25-22(26)18-10-6-3-7-11-18/h2-15,21H,1H3 |
| InChIKey | DUJABKUUVFCBKT-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.86 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |