C15H11ClIN3 — CID 90267623
6-chloro-1-iodo-2,4-diphenyl-2H-1,3,5-triazine (PubChem CID 90267623) has the molecular formula C15H11ClIN3 and a molecular weight of 395.63 g/mol. Its IUPAC name is 6-chloro-1-iodo-2,4-diphenyl-2H-1,3,5-triazine.
| Compound Name | 6-chloro-1-iodo-2,4-diphenyl-2H-1,3,5-triazine |
|---|---|
| PubChem CID | 90267623 |
| Molecular Formula | C15H11ClIN3 |
| Molecular Weight | 395.63 g/mol |
| Exact Mass | 394.97 |
| IUPAC Name | 6-chloro-1-iodo-2,4-diphenyl-2H-1,3,5-triazine |
| SMILES | ClC1=NC(c2ccccc2)=NC(c2ccccc2)N1I |
| InChI | InChI=1S/C15H11ClIN3/c16-15-19-13(11-7-3-1-4-8-11)18-14(20(15)17)12-9-5-2-6-10-12/h1-10,14H |
| InChIKey | SNSPXGWIJCAFPG-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.63 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|