About 6-chloro-1-iodo-2,4-diphenyl-2H-1,3,5-triazine
6-chloro-1-iodo-2,4-diphenyl-2H-1,3,5-triazine (PubChem CID 90267623) has the molecular formula C15H11ClIN3
and a molecular weight of 395.63 g/mol. Its IUPAC name is 6-chloro-1-iodo-2,4-diphenyl-2H-1,3,5-triazine.
Molecular Properties
| Compound Name | 6-chloro-1-iodo-2,4-diphenyl-2H-1,3,5-triazine |
| PubChem CID | 90267623 |
| Molecular Formula | C15H11ClIN3 |
| Molecular Weight | 395.63 g/mol |
| Exact Mass | 394.97 |
| IUPAC Name | 6-chloro-1-iodo-2,4-diphenyl-2H-1,3,5-triazine |
| SMILES | ClC1=NC(c2ccccc2)=NC(c2ccccc2)N1I |
| InChI | InChI=1S/C15H11ClIN3/c16-15-19-13(11-7-3-1-4-8-11)18-14(20(15)17)12-9-5-2-6-10-12/h1-10,14H |
| InChIKey | SNSPXGWIJCAFPG-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.63 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-1-iodo-2,4-diphenyl-2H-1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-1-iodo-2,4-diphenyl-2H-1,3,5-triazine?
The IUPAC name of 6-chloro-1-iodo-2,4-diphenyl-2H-1,3,5-triazine (CID 90267623) is 6-chloro-1-iodo-2,4-diphenyl-2H-1,3,5-triazine.
What is the SMILES notation for 6-chloro-1-iodo-2,4-diphenyl-2H-1,3,5-triazine?
The canonical SMILES for 6-chloro-1-iodo-2,4-diphenyl-2H-1,3,5-triazine is ClC1=NC(c2ccccc2)=NC(c2ccccc2)N1I.
What is the InChIKey of 6-chloro-1-iodo-2,4-diphenyl-2H-1,3,5-triazine?
The InChIKey is SNSPXGWIJCAFPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11ClIN3/c16-15-19-13(11-7-3-1-4-8-11)18-14(20(15)17)12-9-5-2-6-10-12/h1-10,14H.
What are the key properties of 6-chloro-1-iodo-2,4-diphenyl-2H-1,3,5-triazine?
6-chloro-1-iodo-2,4-diphenyl-2H-1,3,5-triazine has a molecular weight of 395.63 g/mol, XLogP of 4.39, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-1-iodo-2,4-diphenyl-2H-1,3,5-triazine is sourced from PubChem (CID 90267623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).