C27H20N4O2S — CID 51715359
(2R)-2-(4-nitrophenyl)-N,N,4-triphenyl-2H-1,3,5-thiadiazin-6-amine (PubChem CID 51715359) has the molecular formula C27H20N4O2S and a molecular weight of 464.55 g/mol. Its IUPAC name is (2R)-2-(4-nitrophenyl)-N,N,4-triphenyl-2H-1,3,5-thiadiazin-6-amine.
| Compound Name | (2R)-2-(4-nitrophenyl)-N,N,4-triphenyl-2H-1,3,5-thiadiazin-6-amine |
|---|---|
| PubChem CID | 51715359 |
| Molecular Formula | C27H20N4O2S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | (2R)-2-(4-nitrophenyl)-N,N,4-triphenyl-2H-1,3,5-thiadiazin-6-amine |
| SMILES | O=[N+]([O-])c1ccc([C@@H]2N=C(c3ccccc3)N=C(N(c3ccccc3)c3ccccc3)S2)cc1 |
| InChI | InChI=1S/C27H20N4O2S/c32-31(33)24-18-16-21(17-19-24)26-28-25(20-10-4-1-5-11-20)29-27(34-26)30(22-12-6-2-7-13-22)23-14-8-3-9-15-23/h1-19,26H/t26-/m1/s1 |
| InChIKey | AZYLXHVICHTYTE-AREMUKBSSA-N |
| XLogP | 6.98 |
| TPSA | 71.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|