C7H12IN — CID 163810866
(2R,6R)-5-iodo-2-methyl-3-azabicyclo[4.1.0]heptane (PubChem CID 163810866) has the molecular formula C7H12IN and a molecular weight of 237.08 g/mol. Its IUPAC name is (2R,6R)-5-iodo-2-methyl-3-azabicyclo[4.1.0]heptane.
| Compound Name | (2R,6R)-5-iodo-2-methyl-3-azabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 163810866 |
| Molecular Formula | C7H12IN |
| Molecular Weight | 237.08 g/mol |
| Exact Mass | 237.00 |
| IUPAC Name | (2R,6R)-5-iodo-2-methyl-3-azabicyclo[4.1.0]heptane |
| SMILES | C[C@H]1NCC(I)[C@@H]2CC21 |
| InChI | InChI=1S/C7H12IN/c1-4-5-2-6(5)7(8)3-9-4/h4-7,9H,2-3H2,1H3/t4-,5?,6-,7?/m1/s1 |
| InChIKey | NNCOUBIVQVAMLU-QGYVGHBZSA-N |
| XLogP | 1.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.08 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|