C9H14IN — CID 174033779
(1R,4S,7aS)-4-iodo-1-methyl-2,3,3a,4,7,7a-hexahydro-1H-isoindole (PubChem CID 174033779) has the molecular formula C9H14IN and a molecular weight of 263.12 g/mol. Its IUPAC name is (1R,4S,7aS)-4-iodo-1-methyl-2,3,3a,4,7,7a-hexahydro-1H-isoindole.
| Compound Name | (1R,4S,7aS)-4-iodo-1-methyl-2,3,3a,4,7,7a-hexahydro-1H-isoindole |
|---|---|
| PubChem CID | 174033779 |
| Molecular Formula | C9H14IN |
| Molecular Weight | 263.12 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | (1R,4S,7aS)-4-iodo-1-methyl-2,3,3a,4,7,7a-hexahydro-1H-isoindole |
| SMILES | C[C@H]1NCC2[C@@H](I)C=CC[C@@H]21 |
| InChI | InChI=1S/C9H14IN/c1-6-7-3-2-4-9(10)8(7)5-11-6/h2,4,6-9,11H,3,5H2,1H3/t6-,7-,8?,9+/m1/s1 |
| InChIKey | VSIPAIWXRJEGRJ-MWBBWYEJSA-N |
| XLogP | 1.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.12 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|