C12H24IN6O2- — CID 163812476
[3-amino-4-[amino-(methylideneamino)iodanuidylamino]-2,4-dimethyl-3-(methylideneamino)pentan-2-yl] 2-aminoprop-2-enoate (PubChem CID 163812476) has the molecular formula C12H24IN6O2- and a molecular weight of 411.27 g/mol. Its IUPAC name is [3-amino-4-[amino-(methylideneamino)iodanuidylamino]-2,4-dimethyl-3-(methylideneamino)pentan-2-yl] 2-aminoprop-2-enoate.
| Compound Name | [3-amino-4-[amino-(methylideneamino)iodanuidylamino]-2,4-dimethyl-3-(methylideneamino)pentan-2-yl] 2-aminoprop-2-enoate |
|---|---|
| PubChem CID | 163812476 |
| Molecular Formula | C12H24IN6O2- |
| Molecular Weight | 411.27 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | [3-amino-4-[amino-(methylideneamino)iodanuidylamino]-2,4-dimethyl-3-(methylideneamino)pentan-2-yl] 2-aminoprop-2-enoate |
| SMILES | C=N[I-]N(N)C(C)(C)C(N)(N=C)C(C)(C)OC(=O)C(=C)N |
| InChI | InChI=1S/C12H24IN6O2/c1-8(14)9(20)21-11(4,5)12(15,17-6)10(2,3)19(16)13-18-7/h1,6-7,14-16H2,2-5H3/q-1 |
| InChIKey | MPIOTCIHODIIJO-UHFFFAOYSA-N |
| XLogP | -3.29 |
| TPSA | 132.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.27 |
| LogP ≤ 5 | -3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|