C14H23F3S — CID 163814764
3-[(1-tert-butylcyclopropyl)methyl]-1-methylsulfanyl-1-(trifluoromethyl)cyclobutane (PubChem CID 163814764) has the molecular formula C14H23F3S and a molecular weight of 280.40 g/mol. Its IUPAC name is 3-[(1-tert-butylcyclopropyl)methyl]-1-methylsulfanyl-1-(trifluoromethyl)cyclobutane.
| Compound Name | 3-[(1-tert-butylcyclopropyl)methyl]-1-methylsulfanyl-1-(trifluoromethyl)cyclobutane |
|---|---|
| PubChem CID | 163814764 |
| Molecular Formula | C14H23F3S |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 3-[(1-tert-butylcyclopropyl)methyl]-1-methylsulfanyl-1-(trifluoromethyl)cyclobutane |
| SMILES | CSC1(C(F)(F)F)CC(CC2(C(C)(C)C)CC2)C1 |
| InChI | InChI=1S/C14H23F3S/c1-11(2,3)12(5-6-12)7-10-8-13(9-10,18-4)14(15,16)17/h10H,5-9H2,1-4H3 |
| InChIKey | NQINGYHLDVNGGX-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |