C25H40N5+ — CID 163822480
4-aminobutyl-[(4-benzylpiperazin-2-yl)methyl]-(3,4,5,6,7,8-hexahydroquinolin-8-yl)azanium (PubChem CID 163822480) has the molecular formula C25H40N5+ and a molecular weight of 410.63 g/mol. Its IUPAC name is 4-aminobutyl-[(4-benzylpiperazin-2-yl)methyl]-(3,4,5,6,7,8-hexahydroquinolin-8-yl)azanium.
| Compound Name | 4-aminobutyl-[(4-benzylpiperazin-2-yl)methyl]-(3,4,5,6,7,8-hexahydroquinolin-8-yl)azanium |
|---|---|
| PubChem CID | 163822480 |
| Molecular Formula | C25H40N5+ |
| Molecular Weight | 410.63 g/mol |
| Exact Mass | 410.33 |
| IUPAC Name | 4-aminobutyl-[(4-benzylpiperazin-2-yl)methyl]-(3,4,5,6,7,8-hexahydroquinolin-8-yl)azanium |
| SMILES | NCCCC[NH+](CC1CN(Cc2ccccc2)CCN1)C1CCCC2=C1N=CCC2 |
| InChI | InChI=1S/C25H39N5/c26-13-4-5-16-30(24-12-6-10-22-11-7-14-28-25(22)24)20-23-19-29(17-15-27-23)18-21-8-2-1-3-9-21/h1-3,8-9,14,23-24,27H,4-7,10-13,15-20,26H2/p+1 |
| InChIKey | NWPCKWDRMWTHHC-UHFFFAOYSA-O |
| XLogP | 1.76 |
| TPSA | 58.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.63 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|