C25H39N5 — CID 163822481
N'-[(4-benzylpiperazin-2-yl)methyl]-N'-(3,4,5,6,7,8-hexahydroquinolin-8-yl)butane-1,4-diamine (PubChem CID 163822481) has the molecular formula C25H39N5 and a molecular weight of 409.62 g/mol. Its IUPAC name is N'-[(4-benzylpiperazin-2-yl)methyl]-N'-(3,4,5,6,7,8-hexahydroquinolin-8-yl)butane-1,4-diamine.
| Compound Name | N'-[(4-benzylpiperazin-2-yl)methyl]-N'-(3,4,5,6,7,8-hexahydroquinolin-8-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 163822481 |
| Molecular Formula | C25H39N5 |
| Molecular Weight | 409.62 g/mol |
| Exact Mass | 409.32 |
| IUPAC Name | N'-[(4-benzylpiperazin-2-yl)methyl]-N'-(3,4,5,6,7,8-hexahydroquinolin-8-yl)butane-1,4-diamine |
| SMILES | NCCCCN(CC1CN(Cc2ccccc2)CCN1)C1CCCC2=C1N=CCC2 |
| InChI | InChI=1S/C25H39N5/c26-13-4-5-16-30(24-12-6-10-22-11-7-14-28-25(22)24)20-23-19-29(17-15-27-23)18-21-8-2-1-3-9-21/h1-3,8-9,14,23-24,27H,4-7,10-13,15-20,26H2 |
| InChIKey | NWPCKWDRMWTHHC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.62 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|