C19H27BrN2O8 — CID 163825548
(2,5-dioxopyrrolidin-1-yl) 3-[2-[(E)-6-bromo-4,7-dioxo-7-(propylamino)hept-5-enoxy]ethoxy]propanoate (PubChem CID 163825548) has the molecular formula C19H27BrN2O8 and a molecular weight of 491.34 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[2-[(E)-6-bromo-4,7-dioxo-7-(propylamino)hept-5-enoxy]ethoxy]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[(E)-6-bromo-4,7-dioxo-7-(propylamino)hept-5-enoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 163825548 |
| Molecular Formula | C19H27BrN2O8 |
| Molecular Weight | 491.34 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[(E)-6-bromo-4,7-dioxo-7-(propylamino)hept-5-enoxy]ethoxy]propanoate |
| SMILES | CCCNC(=O)/C(Br)=C\C(=O)CCCOCCOCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C19H27BrN2O8/c1-2-8-21-19(27)15(20)13-14(23)4-3-9-28-11-12-29-10-7-18(26)30-22-16(24)5-6-17(22)25/h13H,2-12H2,1H3,(H,21,27)/b15-13+ |
| InChIKey | DVDXLKXDWQCETA-FYWRMAATSA-N |
| XLogP | 1.17 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.34 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|