C13H20FN2O4+ — CID 163828452
1-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-3-methyl-5-(2-methylpropyl)oxolan-1-ium-2-yl]pyrimidine-2,4-dione (PubChem CID 163828452) has the molecular formula C13H20FN2O4+ and a molecular weight of 287.31 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-3-methyl-5-(2-methylpropyl)oxolan-1-ium-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-3-methyl-5-(2-methylpropyl)oxolan-1-ium-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 163828452 |
| Molecular Formula | C13H20FN2O4+ |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-3-methyl-5-(2-methylpropyl)oxolan-1-ium-2-yl]pyrimidine-2,4-dione |
| SMILES | CC(C)C[C@H]1[OH+][C@@H](n2ccc(=O)[nH]c2=O)[C@](C)(F)[C@@H]1O |
| InChI | InChI=1S/C13H19FN2O4/c1-7(2)6-8-10(18)13(3,14)11(20-8)16-5-4-9(17)15-12(16)19/h4-5,7-8,10-11,18H,6H2,1-3H3,(H,15,17,19)/p+1/t8-,10-,11-,13-/m1/s1 |
| InChIKey | OBOWTZNMOZNCAB-UORFTKCHSA-O |
| XLogP | 0.08 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|