C12H18 — CID 163830922
(4S)-4-propan-2-yl-4,5,6,7-tetrahydro-1H-indene (PubChem CID 163830922) has the molecular formula C12H18 and a molecular weight of 162.28 g/mol. Its IUPAC name is (4S)-4-propan-2-yl-4,5,6,7-tetrahydro-1H-indene.
| Compound Name | (4S)-4-propan-2-yl-4,5,6,7-tetrahydro-1H-indene |
|---|---|
| PubChem CID | 163830922 |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | (4S)-4-propan-2-yl-4,5,6,7-tetrahydro-1H-indene |
| SMILES | CC(C)[C@@H]1CCCC2=C1C=CC2 |
| InChI | InChI=1S/C12H18/c1-9(2)11-7-3-5-10-6-4-8-12(10)11/h4,8-9,11H,3,5-7H2,1-2H3/t11-/m0/s1 |
| InChIKey | WDZSWXILBZQLEM-NSHDSACASA-N |
| XLogP | 3.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |