C24H40NO5PS — CID 163833316
3-diethoxyphosphorylpropyl 1-[(3R)-3-methyl-4-phenylsulfanylbutyl]piperidine-4-carboxylate (PubChem CID 163833316) has the molecular formula C24H40NO5PS and a molecular weight of 485.63 g/mol. Its IUPAC name is 3-diethoxyphosphorylpropyl 1-[(3R)-3-methyl-4-phenylsulfanylbutyl]piperidine-4-carboxylate.
| Compound Name | 3-diethoxyphosphorylpropyl 1-[(3R)-3-methyl-4-phenylsulfanylbutyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 163833316 |
| Molecular Formula | C24H40NO5PS |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | 3-diethoxyphosphorylpropyl 1-[(3R)-3-methyl-4-phenylsulfanylbutyl]piperidine-4-carboxylate |
| SMILES | CCOP(=O)(CCCOC(=O)C1CCN(CC[C@@H](C)CSc2ccccc2)CC1)OCC |
| InChI | InChI=1S/C24H40NO5PS/c1-4-29-31(27,30-5-2)19-9-18-28-24(26)22-13-16-25(17-14-22)15-12-21(3)20-32-23-10-7-6-8-11-23/h6-8,10-11,21-22H,4-5,9,12-20H2,1-3H3/t21-/m1/s1 |
| InChIKey | JVAADPLZMLFXAK-OAQYLSRUSA-N |
| XLogP | 5.72 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|