C32H20Cl2F3N3O9 — CID 163835566
(2,5-dioxopyrrolidin-1-yl) 1'-acetyl-4,7-dichloro-3-oxo-9'-[(2,2,2-trifluoroacetyl)amino]spiro[2-benzofuran-1,6'-3,4-dihydro-2H-chromeno[3,2-g]quinoline]-5-carboxylate (PubChem CID 163835566) has the molecular formula C32H20Cl2F3N3O9 and a molecular weight of 718.42 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 1'-acetyl-4,7-dichloro-3-oxo-9'-[(2,2,2-trifluoroacetyl)amino]spiro[2-benzofuran-1,6'-3,4-dihydro-2H-chromeno[3,2-g]quinoline]-5-carboxylate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 1'-acetyl-4,7-dichloro-3-oxo-9'-[(2,2,2-trifluoroacetyl)amino]spiro[2-benzofuran-1,6'-3,4-dihydro-2H-chromeno[3,2-g]quinoline]-5-carboxylate |
|---|---|
| PubChem CID | 163835566 |
| Molecular Formula | C32H20Cl2F3N3O9 |
| Molecular Weight | 718.42 g/mol |
| Exact Mass | 717.05 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 1'-acetyl-4,7-dichloro-3-oxo-9'-[(2,2,2-trifluoroacetyl)amino]spiro[2-benzofuran-1,6'-3,4-dihydro-2H-chromeno[3,2-g]quinoline]-5-carboxylate |
| SMILES | CC(=O)N1CCCc2cc3c(cc21)Oc1cc(NC(=O)C(F)(F)F)ccc1C31OC(=O)c2c(Cl)c(C(=O)ON3C(=O)CCC3=O)cc(Cl)c21 |
| InChI | InChI=1S/C32H20Cl2F3N3O9/c1-13(41)39-8-2-3-14-9-18-22(12-20(14)39)47-21-10-15(38-30(46)32(35,36)37)4-5-17(21)31(18)26-19(33)11-16(27(34)25(26)29(45)48-31)28(44)49-40-23(42)6-7-24(40)43/h4-5,9-12H,2-3,6-8H2,1H3,(H,38,46) |
| InChIKey | WDKGWVAYZCGBCZ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 148.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.42 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|