C10H18NS- — CID 163839037
3-methyl-2-sulfido-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline (PubChem CID 163839037) has the molecular formula C10H18NS- and a molecular weight of 184.33 g/mol. Its IUPAC name is 3-methyl-2-sulfido-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline.
| Compound Name | 3-methyl-2-sulfido-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline |
|---|---|
| PubChem CID | 163839037 |
| Molecular Formula | C10H18NS- |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 3-methyl-2-sulfido-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline |
| SMILES | CC1CC2CCCCC2CN1[S-] |
| InChI | InChI=1S/C10H18NS/c1-8-6-9-4-2-3-5-10(9)7-11(8)12/h8-10H,2-7H2,1H3/q-1 |
| InChIKey | DUEKGKZZKHVLCU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|