C17H16FN5O2 — CID 163842257
N-[(2,4-dimethoxyphenyl)methyl]-7-fluoro-4-(methylideneamino)pyrido[3,2-d]pyrimidin-2-amine (PubChem CID 163842257) has the molecular formula C17H16FN5O2 and a molecular weight of 341.35 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-7-fluoro-4-(methylideneamino)pyrido[3,2-d]pyrimidin-2-amine.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-7-fluoro-4-(methylideneamino)pyrido[3,2-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 163842257 |
| Molecular Formula | C17H16FN5O2 |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-7-fluoro-4-(methylideneamino)pyrido[3,2-d]pyrimidin-2-amine |
| SMILES | C=Nc1nc(NCc2ccc(OC)cc2OC)nc2cc(F)cnc12 |
| InChI | InChI=1S/C17H16FN5O2/c1-19-16-15-13(6-11(18)9-20-15)22-17(23-16)21-8-10-4-5-12(24-2)7-14(10)25-3/h4-7,9H,1,8H2,2-3H3,(H,21,22,23) |
| InChIKey | ONABXPYKGDSUBD-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 81.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|