C9H16N3+ — CID 163847774
[amino-[[(3Z,5Z)-hepta-1,3,5-trien-2-yl]amino]methylidene]-methylazanium (PubChem CID 163847774) has the molecular formula C9H16N3+ and a molecular weight of 166.25 g/mol. Its IUPAC name is [amino-[[(3Z,5Z)-hepta-1,3,5-trien-2-yl]amino]methylidene]-methylazanium.
| Compound Name | [amino-[[(3Z,5Z)-hepta-1,3,5-trien-2-yl]amino]methylidene]-methylazanium |
|---|---|
| PubChem CID | 163847774 |
| Molecular Formula | C9H16N3+ |
| Molecular Weight | 166.25 g/mol |
| Exact Mass | 166.13 |
| IUPAC Name | [amino-[[(3Z,5Z)-hepta-1,3,5-trien-2-yl]amino]methylidene]-methylazanium |
| SMILES | C=C(/C=C\C=C/C)N/C(N)=[NH+]/C |
| InChI | InChI=1S/C9H15N3/c1-4-5-6-7-8(2)12-9(10)11-3/h4-7H,2H2,1,3H3,(H3,10,11,12)/p+1/b5-4-,7-6- |
| InChIKey | OCFUIMHHUZJPCR-RZSVFLSASA-O |
| XLogP | -0.75 |
| TPSA | 52.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.25 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|