C19H17BFN3O2S — CID 163848093
CID 163848093 (PubChem CID 163848093) has the molecular formula C19H17BFN3O2S and a molecular weight of 381.24 g/mol.
| Compound Name | CID 163848093 |
|---|---|
| PubChem CID | 163848093 |
| Molecular Formula | C19H17BFN3O2S |
| Molecular Weight | 381.24 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | — |
| SMILES | [B]c1cc(F)ccc1C1N=C(c2nccs2)N2CCCC2=C1C(=O)OCC |
| InChI | InChI=1S/C19H17BFN3O2S/c1-2-26-19(25)15-14-4-3-8-24(14)17(18-22-7-9-27-18)23-16(15)12-6-5-11(21)10-13(12)20/h5-7,9-10,16H,2-4,8H2,1H3 |
| InChIKey | KWIURQVVZOEJFN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.24 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|