C19H19ClFN5O4S2 — CID 138722713
ethyl (8R)-8-(2-chloro-4-fluorophenyl)-3,3-dioxo-10-(1,3-thiazol-2-yl)-1,2,4,5,6,8-hexahydropyrimido[1,6-d][1,2,4,8]thiatriazocine-7-carboxylate (PubChem CID 138722713) has the molecular formula C19H19ClFN5O4S2 and a molecular weight of 499.98 g/mol. Its IUPAC name is ethyl (8R)-8-(2-chloro-4-fluorophenyl)-3,3-dioxo-10-(1,3-thiazol-2-yl)-1,2,4,5,6,8-hexahydropyrimido[1,6-d][1,2,4,8]thiatriazocine-7-carboxylate.
| Compound Name | ethyl (8R)-8-(2-chloro-4-fluorophenyl)-3,3-dioxo-10-(1,3-thiazol-2-yl)-1,2,4,5,6,8-hexahydropyrimido[1,6-d][1,2,4,8]thiatriazocine-7-carboxylate |
|---|---|
| PubChem CID | 138722713 |
| Molecular Formula | C19H19ClFN5O4S2 |
| Molecular Weight | 499.98 g/mol |
| Exact Mass | 499.06 |
| IUPAC Name | ethyl (8R)-8-(2-chloro-4-fluorophenyl)-3,3-dioxo-10-(1,3-thiazol-2-yl)-1,2,4,5,6,8-hexahydropyrimido[1,6-d][1,2,4,8]thiatriazocine-7-carboxylate |
| SMILES | CCOC(=O)C1=C2CCNS(=O)(=O)NCN2C(c2nccs2)=N[C@H]1c1ccc(F)cc1Cl |
| InChI | InChI=1S/C19H19ClFN5O4S2/c1-2-30-19(27)15-14-5-6-23-32(28,29)24-10-26(14)17(18-22-7-8-31-18)25-16(15)12-4-3-11(21)9-13(12)20/h3-4,7-9,16,23-24H,2,5-6,10H2,1H3/t16-/m0/s1 |
| InChIKey | UURJCEZJBPDKQQ-INIZCTEOSA-N |
| XLogP | 2.34 |
| TPSA | 112.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.98 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |