C20H18ClF3N4O4S2 — CID 126756655
ethyl (3R,6S)-3-(2-chloro-4-fluorophenyl)-6-(difluoromethylsulfonylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate (PubChem CID 126756655) has the molecular formula C20H18ClF3N4O4S2 and a molecular weight of 534.97 g/mol. Its IUPAC name is ethyl (3R,6S)-3-(2-chloro-4-fluorophenyl)-6-(difluoromethylsulfonylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate.
| Compound Name | ethyl (3R,6S)-3-(2-chloro-4-fluorophenyl)-6-(difluoromethylsulfonylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 126756655 |
| Molecular Formula | C20H18ClF3N4O4S2 |
| Molecular Weight | 534.97 g/mol |
| Exact Mass | 534.04 |
| IUPAC Name | ethyl (3R,6S)-3-(2-chloro-4-fluorophenyl)-6-(difluoromethylsulfonylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
| SMILES | CCOC(=O)C1=C2C[C@H](NS(=O)(=O)C(F)F)CN2C(c2nccs2)=N[C@H]1c1ccc(F)cc1Cl |
| InChI | InChI=1S/C20H18ClF3N4O4S2/c1-2-32-19(29)15-14-8-11(27-34(30,31)20(23)24)9-28(14)17(18-25-5-6-33-18)26-16(15)12-4-3-10(22)7-13(12)21/h3-7,11,16,20,27H,2,8-9H2,1H3/t11-,16-/m0/s1 |
| InChIKey | VKCPQNVNZHBWIX-ZBEGNZNMSA-N |
| XLogP | 3.47 |
| TPSA | 100.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.97 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |