C19H18ClFN4O4S2 — CID 126756489
methyl (3R,6R)-3-(2-chloro-4-fluorophenyl)-6-(methanesulfonamido)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate (PubChem CID 126756489) has the molecular formula C19H18ClFN4O4S2 and a molecular weight of 484.96 g/mol. Its IUPAC name is methyl (3R,6R)-3-(2-chloro-4-fluorophenyl)-6-(methanesulfonamido)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate.
| Compound Name | methyl (3R,6R)-3-(2-chloro-4-fluorophenyl)-6-(methanesulfonamido)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 126756489 |
| Molecular Formula | C19H18ClFN4O4S2 |
| Molecular Weight | 484.96 g/mol |
| Exact Mass | 484.04 |
| IUPAC Name | methyl (3R,6R)-3-(2-chloro-4-fluorophenyl)-6-(methanesulfonamido)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
| SMILES | COC(=O)C1=C2C[C@@H](NS(C)(=O)=O)CN2C(c2nccs2)=N[C@H]1c1ccc(F)cc1Cl |
| InChI | InChI=1S/C19H18ClFN4O4S2/c1-29-19(26)15-14-8-11(24-31(2,27)28)9-25(14)17(18-22-5-6-30-18)23-16(15)12-4-3-10(21)7-13(12)20/h3-7,11,16,24H,8-9H2,1-2H3/t11-,16+/m1/s1 |
| InChIKey | QXNXJLHRKMJFIA-BZNIZROVSA-N |
| XLogP | 2.49 |
| TPSA | 100.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.96 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |