C18H16F3N5O4S2 — CID 126756720
methyl (3R,6S)-6-(sulfamoylamino)-1-(1,3-thiazol-2-yl)-3-(2,3,4-trifluorophenyl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate (PubChem CID 126756720) has the molecular formula C18H16F3N5O4S2 and a molecular weight of 487.49 g/mol. Its IUPAC name is methyl (3R,6S)-6-(sulfamoylamino)-1-(1,3-thiazol-2-yl)-3-(2,3,4-trifluorophenyl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate.
| Compound Name | methyl (3R,6S)-6-(sulfamoylamino)-1-(1,3-thiazol-2-yl)-3-(2,3,4-trifluorophenyl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 126756720 |
| Molecular Formula | C18H16F3N5O4S2 |
| Molecular Weight | 487.49 g/mol |
| Exact Mass | 487.06 |
| IUPAC Name | methyl (3R,6S)-6-(sulfamoylamino)-1-(1,3-thiazol-2-yl)-3-(2,3,4-trifluorophenyl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
| SMILES | COC(=O)C1=C2C[C@H](NS(N)(=O)=O)CN2C(c2nccs2)=N[C@H]1c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H16F3N5O4S2/c1-30-18(27)12-11-6-8(25-32(22,28)29)7-26(11)16(17-23-4-5-31-17)24-15(12)9-2-3-10(19)14(21)13(9)20/h2-5,8,15,25H,6-7H2,1H3,(H2,22,28,29)/t8-,15-/m0/s1 |
| InChIKey | HGPLRZDHSVWCMZ-AYVTZFPOSA-N |
| XLogP | 1.36 |
| TPSA | 126.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.49 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|