C18H15F3N4O2S — CID 126756660
methyl (6S)-6-amino-1-(1,3-thiazol-2-yl)-3-(2,3,4-trifluorophenyl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate (PubChem CID 126756660) has the molecular formula C18H15F3N4O2S and a molecular weight of 408.41 g/mol. Its IUPAC name is methyl (6S)-6-amino-1-(1,3-thiazol-2-yl)-3-(2,3,4-trifluorophenyl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate.
| Compound Name | methyl (6S)-6-amino-1-(1,3-thiazol-2-yl)-3-(2,3,4-trifluorophenyl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 126756660 |
| Molecular Formula | C18H15F3N4O2S |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | methyl (6S)-6-amino-1-(1,3-thiazol-2-yl)-3-(2,3,4-trifluorophenyl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
| SMILES | COC(=O)C1=C2C[C@H](N)CN2C(c2nccs2)=NC1c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H15F3N4O2S/c1-27-18(26)12-11-6-8(22)7-25(11)16(17-23-4-5-28-17)24-15(12)9-2-3-10(19)14(21)13(9)20/h2-5,8,15H,6-7,22H2,1H3/t8-,15?/m0/s1 |
| InChIKey | NOAYBRSQQLDERR-CYQMCQFNSA-N |
| XLogP | 2.52 |
| TPSA | 80.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|