C20H21ClFN4O3PS — CID 130218739
methyl (3R,6S)-3-(2-chloro-4-fluorophenyl)-6-(ethoxyphosphanylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate (PubChem CID 130218739) has the molecular formula C20H21ClFN4O3PS and a molecular weight of 482.91 g/mol. Its IUPAC name is methyl (3R,6S)-3-(2-chloro-4-fluorophenyl)-6-(ethoxyphosphanylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate.
| Compound Name | methyl (3R,6S)-3-(2-chloro-4-fluorophenyl)-6-(ethoxyphosphanylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 130218739 |
| Molecular Formula | C20H21ClFN4O3PS |
| Molecular Weight | 482.91 g/mol |
| Exact Mass | 482.07 |
| IUPAC Name | methyl (3R,6S)-3-(2-chloro-4-fluorophenyl)-6-(ethoxyphosphanylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
| SMILES | CCOPN[C@H]1CC2=C(C(=O)OC)[C@H](c3ccc(F)cc3Cl)N=C(c3nccs3)N2C1 |
| InChI | InChI=1S/C20H21ClFN4O3PS/c1-3-29-30-25-12-9-15-16(20(27)28-2)17(13-5-4-11(22)8-14(13)21)24-18(26(15)10-12)19-23-6-7-31-19/h4-8,12,17,25,30H,3,9-10H2,1-2H3/t12-,17-/m0/s1 |
| InChIKey | DQRIIFIXNZFWAJ-SJCJKPOMSA-N |
| XLogP | 4.07 |
| TPSA | 76.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.91 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|