C21H18ClF3N4O3S — CID 130209096
ethyl (6S)-3-(2-chloro-4-fluorophenyl)-6-[(2,2-difluoroacetyl)amino]-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate (PubChem CID 130209096) has the molecular formula C21H18ClF3N4O3S and a molecular weight of 498.91 g/mol. Its IUPAC name is ethyl (6S)-3-(2-chloro-4-fluorophenyl)-6-[(2,2-difluoroacetyl)amino]-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate.
| Compound Name | ethyl (6S)-3-(2-chloro-4-fluorophenyl)-6-[(2,2-difluoroacetyl)amino]-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 130209096 |
| Molecular Formula | C21H18ClF3N4O3S |
| Molecular Weight | 498.91 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | ethyl (6S)-3-(2-chloro-4-fluorophenyl)-6-[(2,2-difluoroacetyl)amino]-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
| SMILES | CCOC(=O)C1=C2C[C@H](NC(=O)C(F)F)CN2C(c2nccs2)=NC1c1ccc(F)cc1Cl |
| InChI | InChI=1S/C21H18ClF3N4O3S/c1-2-32-21(31)15-14-8-11(27-19(30)17(24)25)9-29(14)18(20-26-5-6-33-20)28-16(15)12-4-3-10(23)7-13(12)22/h3-7,11,16-17H,2,8-9H2,1H3,(H,27,30)/t11-,16?/m0/s1 |
| InChIKey | PITYIGNROIYSLK-CHPOKUKFSA-N |
| XLogP | 3.71 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.91 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |