C23H21ClFN5O4S2 — CID 160698202
ethyl (3R,6S)-3-(2-chloro-4-fluorophenyl)-6-(3H-pyrrol-2-ylsulfonylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate (PubChem CID 160698202) has the molecular formula C23H21ClFN5O4S2 and a molecular weight of 550.04 g/mol. Its IUPAC name is ethyl (3R,6S)-3-(2-chloro-4-fluorophenyl)-6-(3H-pyrrol-2-ylsulfonylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate.
| Compound Name | ethyl (3R,6S)-3-(2-chloro-4-fluorophenyl)-6-(3H-pyrrol-2-ylsulfonylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 160698202 |
| Molecular Formula | C23H21ClFN5O4S2 |
| Molecular Weight | 550.04 g/mol |
| Exact Mass | 549.07 |
| IUPAC Name | ethyl (3R,6S)-3-(2-chloro-4-fluorophenyl)-6-(3H-pyrrol-2-ylsulfonylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
| SMILES | CCOC(=O)C1=C2C[C@H](NS(=O)(=O)C3=NC=CC3)CN2C(c2nccs2)=N[C@H]1c1ccc(F)cc1Cl |
| InChI | InChI=1S/C23H21ClFN5O4S2/c1-2-34-23(31)19-17-11-14(29-36(32,33)18-4-3-7-26-18)12-30(17)21(22-27-8-9-35-22)28-20(19)15-6-5-13(25)10-16(15)24/h3,5-10,14,20,29H,2,4,11-12H2,1H3/t14-,20-/m0/s1 |
| InChIKey | UMBQYPZVNAZZTA-XOBRGWDASA-N |
| XLogP | 3.56 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.04 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |