C22H22ClFN4O5S2 — CID 126756984
ethyl (3R,6S)-3-(2-chloro-4-fluorophenyl)-6-(oxetan-3-ylsulfonylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate (PubChem CID 126756984) has the molecular formula C22H22ClFN4O5S2 and a molecular weight of 541.03 g/mol. Its IUPAC name is ethyl (3R,6S)-3-(2-chloro-4-fluorophenyl)-6-(oxetan-3-ylsulfonylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate.
| Compound Name | ethyl (3R,6S)-3-(2-chloro-4-fluorophenyl)-6-(oxetan-3-ylsulfonylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 126756984 |
| Molecular Formula | C22H22ClFN4O5S2 |
| Molecular Weight | 541.03 g/mol |
| Exact Mass | 540.07 |
| IUPAC Name | ethyl (3R,6S)-3-(2-chloro-4-fluorophenyl)-6-(oxetan-3-ylsulfonylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
| SMILES | CCOC(=O)C1=C2C[C@H](NS(=O)(=O)C3COC3)CN2C(c2nccs2)=N[C@H]1c1ccc(F)cc1Cl |
| InChI | InChI=1S/C22H22ClFN4O5S2/c1-2-33-22(29)18-17-8-13(27-35(30,31)14-10-32-11-14)9-28(17)20(21-25-5-6-34-21)26-19(18)15-4-3-12(24)7-16(15)23/h3-7,13-14,19,27H,2,8-11H2,1H3/t13-,19-/m0/s1 |
| InChIKey | RDZKPUFINYJOEH-DJJJIMSYSA-N |
| XLogP | 2.65 |
| TPSA | 110.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.03 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |