C22H23ClFN5O4S2 — CID 126757151
ethyl (3R,6S)-3-(2-chloro-4-fluorophenyl)-6-(cyclopropylsulfonylamino)-1-(1,3-thiazol-2-ylamino)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate (PubChem CID 126757151) has the molecular formula C22H23ClFN5O4S2 and a molecular weight of 540.04 g/mol. Its IUPAC name is ethyl (3R,6S)-3-(2-chloro-4-fluorophenyl)-6-(cyclopropylsulfonylamino)-1-(1,3-thiazol-2-ylamino)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate.
| Compound Name | ethyl (3R,6S)-3-(2-chloro-4-fluorophenyl)-6-(cyclopropylsulfonylamino)-1-(1,3-thiazol-2-ylamino)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 126757151 |
| Molecular Formula | C22H23ClFN5O4S2 |
| Molecular Weight | 540.04 g/mol |
| Exact Mass | 539.09 |
| IUPAC Name | ethyl (3R,6S)-3-(2-chloro-4-fluorophenyl)-6-(cyclopropylsulfonylamino)-1-(1,3-thiazol-2-ylamino)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
| SMILES | CCOC(=O)C1=C2C[C@H](NS(=O)(=O)C3CC3)CN2C(Nc2nccs2)=N[C@H]1c1ccc(F)cc1Cl |
| InChI | InChI=1S/C22H23ClFN5O4S2/c1-2-33-20(30)18-17-10-13(28-35(31,32)14-4-5-14)11-29(17)21(27-22-25-7-8-34-22)26-19(18)15-6-3-12(24)9-16(15)23/h3,6-9,13-14,19,28H,2,4-5,10-11H2,1H3,(H,25,26,27)/t13-,19-/m0/s1 |
| InChIKey | CJPBRGRBBIUSIV-DJJJIMSYSA-N |
| XLogP | 3.43 |
| TPSA | 112.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.04 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |