C19H18ClFN4O2S — CID 144966043
ethyl (3R,6S)-6-amino-3-(4-chloro-2-fluorophenyl)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate (PubChem CID 144966043) has the molecular formula C19H18ClFN4O2S and a molecular weight of 420.90 g/mol. Its IUPAC name is ethyl (3R,6S)-6-amino-3-(4-chloro-2-fluorophenyl)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate.
| Compound Name | ethyl (3R,6S)-6-amino-3-(4-chloro-2-fluorophenyl)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 144966043 |
| Molecular Formula | C19H18ClFN4O2S |
| Molecular Weight | 420.90 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | ethyl (3R,6S)-6-amino-3-(4-chloro-2-fluorophenyl)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
| SMILES | CCOC(=O)C1=C2C[C@H](N)CN2C(c2nccs2)=N[C@H]1c1ccc(Cl)cc1F |
| InChI | InChI=1S/C19H18ClFN4O2S/c1-2-27-19(26)15-14-8-11(22)9-25(14)17(18-23-5-6-28-18)24-16(15)12-4-3-10(20)7-13(12)21/h3-7,11,16H,2,8-9,22H2,1H3/t11-,16-/m0/s1 |
| InChIKey | XKNLFLNEVWDWLD-ZBEGNZNMSA-N |
| XLogP | 3.29 |
| TPSA | 80.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.90 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |