C21H22ClFN6O2S2 — CID 152845422
N-[(3R,6S)-4-(1-amino-3-methyliminoprop-1-enyl)-3-(2-chloro-4-fluorophenyl)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]methanesulfonamide (PubChem CID 152845422) has the molecular formula C21H22ClFN6O2S2 and a molecular weight of 509.03 g/mol. Its IUPAC name is N-[(3R,6S)-4-(1-amino-3-methyliminoprop-1-enyl)-3-(2-chloro-4-fluorophenyl)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]methanesulfonamide.
| Compound Name | N-[(3R,6S)-4-(1-amino-3-methyliminoprop-1-enyl)-3-(2-chloro-4-fluorophenyl)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]methanesulfonamide |
|---|---|
| PubChem CID | 152845422 |
| Molecular Formula | C21H22ClFN6O2S2 |
| Molecular Weight | 509.03 g/mol |
| Exact Mass | 508.09 |
| IUPAC Name | N-[(3R,6S)-4-(1-amino-3-methyliminoprop-1-enyl)-3-(2-chloro-4-fluorophenyl)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]methanesulfonamide |
| SMILES | C/N=C/C=C(N)C1=C2C[C@H](NS(C)(=O)=O)CN2C(c2nccs2)=N[C@H]1c1ccc(F)cc1Cl |
| InChI | InChI=1S/C21H22ClFN6O2S2/c1-25-6-5-16(24)18-17-10-13(28-33(2,30)31)11-29(17)20(21-26-7-8-32-21)27-19(18)14-4-3-12(23)9-15(14)22/h3-9,13,19,28H,10-11,24H2,1-2H3/b16-5?,25-6+/t13-,19-/m0/s1 |
| InChIKey | FFDYKJQPKXNSIN-ZKSGMSJFSA-N |
| XLogP | 2.86 |
| TPSA | 113.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.03 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|