C45H37N3O6 — CID 163848625
3,5-bis[(4-phenoxybenzoyl)amino]-N-(4-phenoxycyclohexen-1-yl)benzamide (PubChem CID 163848625) has the molecular formula C45H37N3O6 and a molecular weight of 715.81 g/mol. Its IUPAC name is 3,5-bis[(4-phenoxybenzoyl)amino]-N-(4-phenoxycyclohexen-1-yl)benzamide.
| Compound Name | 3,5-bis[(4-phenoxybenzoyl)amino]-N-(4-phenoxycyclohexen-1-yl)benzamide |
|---|---|
| PubChem CID | 163848625 |
| Molecular Formula | C45H37N3O6 |
| Molecular Weight | 715.81 g/mol |
| Exact Mass | 715.27 |
| IUPAC Name | 3,5-bis[(4-phenoxybenzoyl)amino]-N-(4-phenoxycyclohexen-1-yl)benzamide |
| SMILES | O=C(NC1=CCC(Oc2ccccc2)CC1)c1cc(NC(=O)c2ccc(Oc3ccccc3)cc2)cc(NC(=O)c2ccc(Oc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C45H37N3O6/c49-43(31-16-22-40(23-17-31)52-37-10-4-1-5-11-37)47-35-28-33(45(51)46-34-20-26-42(27-21-34)54-39-14-8-3-9-15-39)29-36(30-35)48-44(50)32-18-24-41(25-19-32)53-38-12-6-2-7-13-38/h1-20,22-25,28-30,42H,21,26-27H2,(H,46,51)(H,47,49)(H,48,50) |
| InChIKey | OSJQRFLQMFEOQL-UHFFFAOYSA-N |
| XLogP | 10.02 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.81 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |