C8H11NO3S — CID 163856623
3-(2-hydroxysulfanylethyl)-3,6-dihydro-2H-[1,4]dioxino[2,3-c]pyrrole (PubChem CID 163856623) has the molecular formula C8H11NO3S and a molecular weight of 201.25 g/mol. Its IUPAC name is 3-(2-hydroxysulfanylethyl)-3,6-dihydro-2H-[1,4]dioxino[2,3-c]pyrrole.
| Compound Name | 3-(2-hydroxysulfanylethyl)-3,6-dihydro-2H-[1,4]dioxino[2,3-c]pyrrole |
|---|---|
| PubChem CID | 163856623 |
| Molecular Formula | C8H11NO3S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.05 |
| IUPAC Name | 3-(2-hydroxysulfanylethyl)-3,6-dihydro-2H-[1,4]dioxino[2,3-c]pyrrole |
| SMILES | OSCCC1COc2c[nH]cc2O1 |
| InChI | InChI=1S/C8H11NO3S/c10-13-2-1-6-5-11-7-3-9-4-8(7)12-6/h3-4,6,9-10H,1-2,5H2 |
| InChIKey | OYVNPDBMPADAJV-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 54.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|