C10H22N2 — CID 163857353
1-N',4,5-trimethyl-2-methylidenehexane-1,1-diamine (PubChem CID 163857353) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is 1-N',4,5-trimethyl-2-methylidenehexane-1,1-diamine.
| Compound Name | 1-N',4,5-trimethyl-2-methylidenehexane-1,1-diamine |
|---|---|
| PubChem CID | 163857353 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | 1-N',4,5-trimethyl-2-methylidenehexane-1,1-diamine |
| SMILES | C=C(CC(C)C(C)C)C(N)NC |
| InChI | InChI=1S/C10H22N2/c1-7(2)8(3)6-9(4)10(11)12-5/h7-8,10,12H,4,6,11H2,1-3,5H3 |
| InChIKey | OZLMHAMZWNSMFI-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|