C12H21ClN2O3S — CID 163858461
1-chloro-5,5-dimethyl-3-[2-(2-propan-2-yloxyethylsulfanyl)ethyl]imidazolidine-2,4-dione (PubChem CID 163858461) has the molecular formula C12H21ClN2O3S and a molecular weight of 308.83 g/mol. Its IUPAC name is 1-chloro-5,5-dimethyl-3-[2-(2-propan-2-yloxyethylsulfanyl)ethyl]imidazolidine-2,4-dione.
| Compound Name | 1-chloro-5,5-dimethyl-3-[2-(2-propan-2-yloxyethylsulfanyl)ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 163858461 |
| Molecular Formula | C12H21ClN2O3S |
| Molecular Weight | 308.83 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 1-chloro-5,5-dimethyl-3-[2-(2-propan-2-yloxyethylsulfanyl)ethyl]imidazolidine-2,4-dione |
| SMILES | CC(C)OCCSCCN1C(=O)N(Cl)C(C)(C)C1=O |
| InChI | InChI=1S/C12H21ClN2O3S/c1-9(2)18-6-8-19-7-5-14-10(16)12(3,4)15(13)11(14)17/h9H,5-8H2,1-4H3 |
| InChIKey | PAKZPQLHXYZLSI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.83 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|