C10H18ClN3O4 — CID 101266534
3-[[bis(2-hydroxyethyl)amino]methyl]-1-chloro-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 101266534) has the molecular formula C10H18ClN3O4 and a molecular weight of 279.72 g/mol. Its IUPAC name is 3-[[bis(2-hydroxyethyl)amino]methyl]-1-chloro-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[[bis(2-hydroxyethyl)amino]methyl]-1-chloro-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 101266534 |
| Molecular Formula | C10H18ClN3O4 |
| Molecular Weight | 279.72 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 3-[[bis(2-hydroxyethyl)amino]methyl]-1-chloro-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC1(C)C(=O)N(CN(CCO)CCO)C(=O)N1Cl |
| InChI | InChI=1S/C10H18ClN3O4/c1-10(2)8(17)13(9(18)14(10)11)7-12(3-5-15)4-6-16/h15-16H,3-7H2,1-2H3 |
| InChIKey | ABNHYUPKUCQZSA-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.72 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|