C21H21NO3S — CID 163859650
(5E)-5-[[2-[(4-methoxyphenyl)methyl]-3,4-dihydro-2H-chromen-6-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 163859650) has the molecular formula C21H21NO3S and a molecular weight of 367.47 g/mol. Its IUPAC name is (5E)-5-[[2-[(4-methoxyphenyl)methyl]-3,4-dihydro-2H-chromen-6-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[2-[(4-methoxyphenyl)methyl]-3,4-dihydro-2H-chromen-6-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 163859650 |
| Molecular Formula | C21H21NO3S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | (5E)-5-[[2-[(4-methoxyphenyl)methyl]-3,4-dihydro-2H-chromen-6-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(CC2CCc3cc(/C=C4/SCNC4=O)ccc3O2)cc1 |
| InChI | InChI=1S/C21H21NO3S/c1-24-17-6-2-14(3-7-17)11-18-8-5-16-10-15(4-9-19(16)25-18)12-20-21(23)22-13-26-20/h2-4,6-7,9-10,12,18H,5,8,11,13H2,1H3,(H,22,23)/b20-12+ |
| InChIKey | PBIWAWMZYIENCP-UDWIEESQSA-N |
| XLogP | 3.79 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|