C12H9N3OS — CID 173010314
5-(quinoxalin-6-ylmethylidene)-1,3-thiazolidin-4-one (PubChem CID 173010314) has the molecular formula C12H9N3OS and a molecular weight of 243.29 g/mol. Its IUPAC name is 5-(quinoxalin-6-ylmethylidene)-1,3-thiazolidin-4-one.
| Compound Name | 5-(quinoxalin-6-ylmethylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 173010314 |
| Molecular Formula | C12H9N3OS |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 5-(quinoxalin-6-ylmethylidene)-1,3-thiazolidin-4-one |
| SMILES | O=C1NCSC1=Cc1ccc2nccnc2c1 |
| InChI | InChI=1S/C12H9N3OS/c16-12-11(17-7-15-12)6-8-1-2-9-10(5-8)14-4-3-13-9/h1-6H,7H2,(H,15,16) |
| InChIKey | OAXGTCLEKNKWOV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|