C26H33N — CID 163860478
[2-[(Z)-4-(4-ethenyl-3-ethylphenyl)-4-ethylhex-2-en-3-yl]-6-methylphenyl]methanimine (PubChem CID 163860478) has the molecular formula C26H33N and a molecular weight of 359.56 g/mol. Its IUPAC name is [2-[(Z)-4-(4-ethenyl-3-ethylphenyl)-4-ethylhex-2-en-3-yl]-6-methylphenyl]methanimine.
| Compound Name | [2-[(Z)-4-(4-ethenyl-3-ethylphenyl)-4-ethylhex-2-en-3-yl]-6-methylphenyl]methanimine |
|---|---|
| PubChem CID | 163860478 |
| Molecular Formula | C26H33N |
| Molecular Weight | 359.56 g/mol |
| Exact Mass | 359.26 |
| IUPAC Name | [2-[(Z)-4-(4-ethenyl-3-ethylphenyl)-4-ethylhex-2-en-3-yl]-6-methylphenyl]methanimine |
| SMILES | [H]/N=C\c1c(C)cccc1/C(=C\C)C(CC)(CC)c1ccc(C=C)c(CC)c1 |
| InChI | InChI=1S/C26H33N/c1-7-20-15-16-22(17-21(20)8-2)26(10-4,11-5)25(9-3)23-14-12-13-19(6)24(23)18-27/h7,9,12-18,27H,1,8,10-11H2,2-6H3/b25-9+,27-18- |
| InChIKey | PCBQPAPUZLRUHC-OVXQRGNESA-N |
| XLogP | 7.36 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.56 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|