C19H18O6 — CID 163863889
1-(3,4,5a,9-tetrahydroxy-10-methyl-10b,11-dihydro-6H-indeno[2,1-b]chromen-8-yl)ethanone (PubChem CID 163863889) has the molecular formula C19H18O6 and a molecular weight of 342.35 g/mol. Its IUPAC name is 1-(3,4,5a,9-tetrahydroxy-10-methyl-10b,11-dihydro-6H-indeno[2,1-b]chromen-8-yl)ethanone.
| Compound Name | 1-(3,4,5a,9-tetrahydroxy-10-methyl-10b,11-dihydro-6H-indeno[2,1-b]chromen-8-yl)ethanone |
|---|---|
| PubChem CID | 163863889 |
| Molecular Formula | C19H18O6 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 1-(3,4,5a,9-tetrahydroxy-10-methyl-10b,11-dihydro-6H-indeno[2,1-b]chromen-8-yl)ethanone |
| SMILES | CC(=O)c1cc2c(c(C)c1O)C1Cc3ccc(O)c(O)c3OC1(O)C2 |
| InChI | InChI=1S/C19H18O6/c1-8-15-11(5-12(9(2)20)16(8)22)7-19(24)13(15)6-10-3-4-14(21)17(23)18(10)25-19/h3-5,13,21-24H,6-7H2,1-2H3 |
| InChIKey | PEXPHQPDXQVFML-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|